About ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate
ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate (PubChem CID 59003951) has the molecular formula C23H23ClF2N2O3
and a molecular weight of 448.90 g/mol. Its IUPAC name is ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate |
| PubChem CID | 59003951 |
| Molecular Formula | C23H23ClF2N2O3 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate |
| SMILES | CCOC(=O)CN1CCC2(CC1)CN(C(=O)c1c(F)cccc1F)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C23H23ClF2N2O3/c1-2-31-20(29)13-27-10-8-23(9-11-27)14-28(19-7-6-15(24)12-16(19)23)22(30)21-17(25)4-3-5-18(21)26/h3-7,12H,2,8-11,13-14H2,1H3 |
| InChIKey | VZDICDRGGPDVPO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate?
The IUPAC name of ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate (CID 59003951) is ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate.
What is the SMILES notation for ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate?
The canonical SMILES for ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate is CCOC(=O)CN1CCC2(CC1)CN(C(=O)c1c(F)cccc1F)c1ccc(Cl)cc12.
What is the InChIKey of ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate?
The InChIKey is VZDICDRGGPDVPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23ClF2N2O3/c1-2-31-20(29)13-27-10-8-23(9-11-27)14-28(19-7-6-15(24)12-16(19)23)22(30)21-17(25)4-3-5-18(21)26/h3-7,12H,2,8-11,13-14H2,1H3.
What are the key properties of ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate?
ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate has a molecular weight of 448.90 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-chloro-1-(2,6-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]acetate is sourced from PubChem (CID 59003951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).