About (E)-2,3-difluoro-6-methylhept-2-ene
(E)-2,3-difluoro-6-methylhept-2-ene (PubChem CID 59003983) has the molecular formula C8H14F2
and a molecular weight of 148.20 g/mol. Its IUPAC name is (E)-2,3-difluoro-6-methylhept-2-ene.
Molecular Properties
| Compound Name | (E)-2,3-difluoro-6-methylhept-2-ene |
| PubChem CID | 59003983 |
| Molecular Formula | C8H14F2 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | (E)-2,3-difluoro-6-methylhept-2-ene |
| SMILES | C/C(F)=C(\F)CCC(C)C |
| InChI | InChI=1S/C8H14F2/c1-6(2)4-5-8(10)7(3)9/h6H,4-5H2,1-3H3/b8-7+ |
| InChIKey | PHJKRLNQWQNDOT-BQYQJAHWSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (E)-2,3-difluoro-6-methylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-difluoro-6-methylhept-2-ene?
The IUPAC name of (E)-2,3-difluoro-6-methylhept-2-ene (CID 59003983) is (E)-2,3-difluoro-6-methylhept-2-ene.
What is the SMILES notation for (E)-2,3-difluoro-6-methylhept-2-ene?
The canonical SMILES for (E)-2,3-difluoro-6-methylhept-2-ene is C/C(F)=C(\F)CCC(C)C.
What is the InChIKey of (E)-2,3-difluoro-6-methylhept-2-ene?
The InChIKey is PHJKRLNQWQNDOT-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H14F2/c1-6(2)4-5-8(10)7(3)9/h6H,4-5H2,1-3H3/b8-7+.
What are the key properties of (E)-2,3-difluoro-6-methylhept-2-ene?
(E)-2,3-difluoro-6-methylhept-2-ene has a molecular weight of 148.20 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-difluoro-6-methylhept-2-ene is sourced from PubChem (CID 59003983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).