About tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate
tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate (PubChem CID 59004058) has the molecular formula C20H27FN2O2
and a molecular weight of 346.45 g/mol. Its IUPAC name is tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate |
| PubChem CID | 59004058 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate |
| SMILES | C=CCN1CCC2(CC1)CN(C(=O)OC(C)(C)C)c1ccc(F)cc12 |
| InChI | InChI=1S/C20H27FN2O2/c1-5-10-22-11-8-20(9-12-22)14-23(18(24)25-19(2,3)4)17-7-6-15(21)13-16(17)20/h5-7,13H,1,8-12,14H2,2-4H3 |
| InChIKey | KEOIOUSWBUQGLU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate?
The IUPAC name of tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate (CID 59004058) is tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate.
What is the SMILES notation for tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate?
The canonical SMILES for tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate is C=CCN1CCC2(CC1)CN(C(=O)OC(C)(C)C)c1ccc(F)cc12.
What is the InChIKey of tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate?
The InChIKey is KEOIOUSWBUQGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27FN2O2/c1-5-10-22-11-8-20(9-12-22)14-23(18(24)25-19(2,3)4)17-7-6-15(21)13-16(17)20/h5-7,13H,1,8-12,14H2,2-4H3.
What are the key properties of tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate?
tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate has a molecular weight of 346.45 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-fluoro-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-carboxylate is sourced from PubChem (CID 59004058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).