C23H23ClF2N2O — CID 59004159
(1'-but-3-enyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone (PubChem CID 59004159) has the molecular formula C23H23ClF2N2O and a molecular weight of 416.90 g/mol. Its IUPAC name is (1'-but-3-enyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone.
| Compound Name | (1'-but-3-enyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 59004159 |
| Molecular Formula | C23H23ClF2N2O |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (1'-but-3-enyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone |
| SMILES | C=CCCN1CCC2(CC1)CN(C(=O)c1c(F)cccc1F)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C23H23ClF2N2O/c1-2-3-11-27-12-9-23(10-13-27)15-28(20-8-7-16(24)14-17(20)23)22(29)21-18(25)5-4-6-19(21)26/h2,4-8,14H,1,3,9-13,15H2 |
| InChIKey | QKPSTNGNDWHYCH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|