About [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol
[(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol (PubChem CID 59004429) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol |
| PubChem CID | 59004429 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol |
| SMILES | CCN1C[C@H](CO)C[C@@H](CC(C)(C)C)C1 |
| InChI | InChI=1S/C13H27NO/c1-5-14-8-11(7-13(2,3)4)6-12(9-14)10-15/h11-12,15H,5-10H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | DMWVJHJGLMEWNZ-NWDGAFQWSA-N |
| XLogP | 2.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol?
The IUPAC name of [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol (CID 59004429) is [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol.
What is the SMILES notation for [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol?
The canonical SMILES for [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol is CCN1C[C@H](CO)C[C@@H](CC(C)(C)C)C1.
What is the InChIKey of [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol?
The InChIKey is DMWVJHJGLMEWNZ-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H27NO/c1-5-14-8-11(7-13(2,3)4)6-12(9-14)10-15/h11-12,15H,5-10H2,1-4H3/t11-,12+/m0/s1.
What are the key properties of [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol?
[(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol has a molecular weight of 213.36 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-5-(2,2-dimethylpropyl)-1-ethylpiperidin-3-yl]methanol is sourced from PubChem (CID 59004429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).