About 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine
5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine (PubChem CID 59004562) has the molecular formula C15H13N3O
and a molecular weight of 251.29 g/mol. Its IUPAC name is 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine |
| PubChem CID | 59004562 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine |
| SMILES | Cc1ccc(-c2ccno2)cc1-c1ccc(N)nc1 |
| InChI | InChI=1S/C15H13N3O/c1-10-2-3-11(14-6-7-18-19-14)8-13(10)12-4-5-15(16)17-9-12/h2-9H,1H3,(H2,16,17) |
| InChIKey | SCMQTJOZIYSDEW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine?
The IUPAC name of 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine (CID 59004562) is 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine.
What is the SMILES notation for 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine?
The canonical SMILES for 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine is Cc1ccc(-c2ccno2)cc1-c1ccc(N)nc1.
What is the InChIKey of 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine?
The InChIKey is SCMQTJOZIYSDEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O/c1-10-2-3-11(14-6-7-18-19-14)8-13(10)12-4-5-15(16)17-9-12/h2-9H,1H3,(H2,16,17).
What are the key properties of 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine?
5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine has a molecular weight of 251.29 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-methyl-5-(1,2-oxazol-5-yl)phenyl]pyridin-2-amine is sourced from PubChem (CID 59004562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).