C20H14N2O2 — CID 59005079
5,6a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 59005079) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5,6a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,6a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 59005079 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5,6a,12,12a-tetrahydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | O=C1c2ccccc2NC2C=c3c([nH]c4ccccc4c3=O)=CC12 |
| InChI | InChI=1S/C20H14N2O2/c23-19-11-5-1-3-7-15(11)21-17-10-14-18(9-13(17)19)22-16-8-4-2-6-12(16)20(14)24/h1-10,13,17,21-22H |
| InChIKey | LIRNMPRXSZBIFS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |