C40H34N2O6 — CID 59005438
6,13-bis(4-cyclopentyl-3-ethenoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 59005438) has the molecular formula C40H34N2O6 and a molecular weight of 638.72 g/mol. Its IUPAC name is 6,13-bis(4-cyclopentyl-3-ethenoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(4-cyclopentyl-3-ethenoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 59005438 |
| Molecular Formula | C40H34N2O6 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | 6,13-bis(4-cyclopentyl-3-ethenoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | C=COc1cc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccc(C3CCCC3)c(OC=C)c2)C4=O)ccc1C1CCCC1 |
| InChI | InChI=1S/C40H34N2O6/c1-3-47-33-21-25(13-15-27(33)23-9-5-6-10-23)41-37(43)29-17-19-31-36-32(20-18-30(35(29)36)38(41)44)40(46)42(39(31)45)26-14-16-28(24-11-7-8-12-24)34(22-26)48-4-2/h3-4,13-24H,1-2,5-12H2 |
| InChIKey | BBTXORFYZVYYEL-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|