C22H13F12IrN2O- — CID 59005633
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium (PubChem CID 59005633) has the molecular formula C22H13F12IrN2O- and a molecular weight of 741.55 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium |
|---|---|
| PubChem CID | 59005633 |
| Molecular Formula | C22H13F12IrN2O- |
| Molecular Weight | 741.55 g/mol |
| Exact Mass | 742.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-methylpyridine;1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium |
| SMILES | Cc1ccnc(-c2[c-]c(C(F)(F)F)cc(C(F)(F)F)c2)c1.OC(c1ccccn1)(C(F)(F)F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C14H8F6N.C8H5F6NO.Ir/c1-8-2-3-21-12(4-8)9-5-10(13(15,16)17)7-11(6-9)14(18,19)20;9-7(10,11)6(16,8(12,13)14)5-3-1-2-4-15-5;/h2-5,7H,1H3;1-4,16H;/q-1;; |
| InChIKey | BEZSCOSCOOJPBX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.55 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|