C10H5F8NS — CID 59005651
5-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-1,3-thiazole (PubChem CID 59005651) has the molecular formula C10H5F8NS and a molecular weight of 323.21 g/mol. Its IUPAC name is 5-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-1,3-thiazole.
| Compound Name | 5-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 59005651 |
| Molecular Formula | C10H5F8NS |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 5-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-1,3-thiazole |
| SMILES | Cc1cnc(C2=CC(F)(F)C(F)(F)C(F)(F)C2(F)F)s1 |
| InChI | InChI=1S/C10H5F8NS/c1-4-3-19-6(20-4)5-2-7(11,12)9(15,16)10(17,18)8(5,13)14/h2-3H,1H3 |
| InChIKey | LKLXWGQGJASDDW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|