C22H12F8IrN2-2 — CID 59005685
iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;2-phenylpyridine (PubChem CID 59005685) has the molecular formula C22H12F8IrN2-2 and a molecular weight of 648.55 g/mol. Its IUPAC name is iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;2-phenylpyridine.
| Compound Name | iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;2-phenylpyridine |
|---|---|
| PubChem CID | 59005685 |
| Molecular Formula | C22H12F8IrN2-2 |
| Molecular Weight | 648.55 g/mol |
| Exact Mass | 649.05 |
| IUPAC Name | iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;2-phenylpyridine |
| SMILES | FC1(F)[C-]=C(c2ccccn2)C(F)(F)C(F)(F)C1(F)F.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H4F8N.C11H8N.Ir/c12-8(13)5-6(7-3-1-2-4-20-7)9(14,15)11(18,19)10(8,16)17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-4H;1-6,8-9H;/q2*-1; |
| InChIKey | LVIPEYSMDYHCAT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|