C15H12F8IrN- — CID 59005710
4-tert-butyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;iridium (PubChem CID 59005710) has the molecular formula C15H12F8IrN- and a molecular weight of 550.47 g/mol. Its IUPAC name is 4-tert-butyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;iridium.
| Compound Name | 4-tert-butyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;iridium |
|---|---|
| PubChem CID | 59005710 |
| Molecular Formula | C15H12F8IrN- |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 4-tert-butyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;iridium |
| SMILES | CC(C)(C)c1ccnc(C2=[C-]C(F)(F)C(F)(F)C(F)(F)C2(F)F)c1.[Ir] |
| InChI | InChI=1S/C15H12F8N.Ir/c1-11(2,3)8-4-5-24-10(6-8)9-7-12(16,17)14(20,21)15(22,23)13(9,18)19;/h4-6H,1-3H3;/q-1; |
| InChIKey | HTRPPBTXGJOFFP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|