C10H5F8N — CID 59005740
5-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-2H-pyrrole (PubChem CID 59005740) has the molecular formula C10H5F8N and a molecular weight of 291.14 g/mol. Its IUPAC name is 5-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-2H-pyrrole.
| Compound Name | 5-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-2H-pyrrole |
|---|---|
| PubChem CID | 59005740 |
| Molecular Formula | C10H5F8N |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 5-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)-2H-pyrrole |
| SMILES | FC1(F)C=C(C2=NCC=C2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H5F8N/c11-7(12)4-5(6-2-1-3-19-6)8(13,14)10(17,18)9(7,15)16/h1-2,4H,3H2 |
| InChIKey | MDTKOABIJDBNBK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|