C11H3F9IrN- — CID 59005755
2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)-4-(trifluoromethyl)pyridine;iridium (PubChem CID 59005755) has the molecular formula C11H3F9IrN- and a molecular weight of 512.35 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)-4-(trifluoromethyl)pyridine;iridium.
| Compound Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)-4-(trifluoromethyl)pyridine;iridium |
|---|---|
| PubChem CID | 59005755 |
| Molecular Formula | C11H3F9IrN- |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)-4-(trifluoromethyl)pyridine;iridium |
| SMILES | FC(F)(F)c1ccnc(C2=[C-]C(F)(F)C(F)(F)C2(F)F)c1.[Ir] |
| InChI | InChI=1S/C11H3F9N.Ir/c12-8(13)4-6(9(14,15)11(8,19)20)7-3-5(1-2-21-7)10(16,17)18;/h1-3H;/q-1; |
| InChIKey | CERODFOMNYJEGW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|