C16H13F8IrNO2 — CID 59005759
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine (PubChem CID 59005759) has the molecular formula C16H13F8IrNO2 and a molecular weight of 595.49 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine.
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine |
|---|---|
| PubChem CID | 59005759 |
| Molecular Formula | C16H13F8IrNO2 |
| Molecular Weight | 595.49 g/mol |
| Exact Mass | 596.04 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine |
| SMILES | FC1(F)[C-]=C(c2ccccn2)C(F)(F)C(F)(F)C1(F)F.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C11H4F8N.C5H8O2.Ir/c12-8(13)5-6(7-3-1-2-4-20-7)9(14,15)11(18,19)10(8,16)17;1-4(6)3-5(2)7;/h1-4H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | DKRXTWQCCWSRNQ-LWFKIUJUSA-O |
| XLogP | 4.83 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|