C16H18F4IrN- — CID 59005799
iridium;5-methyl-2-(3,3,6,6-tetrafluoro-4,4,5,5-tetramethylcyclohexen-1-yl)pyridine (PubChem CID 59005799) has the molecular formula C16H18F4IrN- and a molecular weight of 492.54 g/mol. Its IUPAC name is iridium;5-methyl-2-(3,3,6,6-tetrafluoro-4,4,5,5-tetramethylcyclohexen-1-yl)pyridine.
| Compound Name | iridium;5-methyl-2-(3,3,6,6-tetrafluoro-4,4,5,5-tetramethylcyclohexen-1-yl)pyridine |
|---|---|
| PubChem CID | 59005799 |
| Molecular Formula | C16H18F4IrN- |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | iridium;5-methyl-2-(3,3,6,6-tetrafluoro-4,4,5,5-tetramethylcyclohexen-1-yl)pyridine |
| SMILES | Cc1ccc(C2=[C-]C(F)(F)C(C)(C)C(C)(C)C2(F)F)nc1.[Ir] |
| InChI | InChI=1S/C16H18F4N.Ir/c1-10-6-7-12(21-9-10)11-8-15(17,18)13(2,3)14(4,5)16(11,19)20;/h6-7,9H,1-5H3;/q-1; |
| InChIKey | OLEWSSLTDHEYRB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|