C9H3F6IrN2- — CID 59005824
2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyrimidine;iridium (PubChem CID 59005824) has the molecular formula C9H3F6IrN2- and a molecular weight of 445.34 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyrimidine;iridium.
| Compound Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyrimidine;iridium |
|---|---|
| PubChem CID | 59005824 |
| Molecular Formula | C9H3F6IrN2- |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 2-(3,3,4,4,5,5-hexafluorocyclopenten-1-yl)pyrimidine;iridium |
| SMILES | FC1(F)[C-]=C(c2ncccn2)C(F)(F)C1(F)F.[Ir] |
| InChI | InChI=1S/C9H3F6N2.Ir/c10-7(11)4-5(6-16-2-1-3-17-6)8(12,13)9(7,14)15;/h1-3H;/q-1; |
| InChIKey | DHFFWESVILBTHY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|