C26H17F8IrNO2 — CID 59005856
[(Z)-3-hydroxy-1,3-diphenylprop-2-enylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine (PubChem CID 59005856) has the molecular formula C26H17F8IrNO2 and a molecular weight of 719.63 g/mol. Its IUPAC name is [(Z)-3-hydroxy-1,3-diphenylprop-2-enylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine.
| Compound Name | [(Z)-3-hydroxy-1,3-diphenylprop-2-enylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine |
|---|---|
| PubChem CID | 59005856 |
| Molecular Formula | C26H17F8IrNO2 |
| Molecular Weight | 719.63 g/mol |
| Exact Mass | 720.08 |
| IUPAC Name | [(Z)-3-hydroxy-1,3-diphenylprop-2-enylidene]oxidanium;iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine |
| SMILES | FC1(F)[C-]=C(c2ccccn2)C(F)(F)C(F)(F)C1(F)F.[H]/[O+]=C(/C=C(\O)c1ccccc1)c1ccccc1.[Ir] |
| InChI | InChI=1S/C15H12O2.C11H4F8N.Ir/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;12-8(13)5-6(7-3-1-2-4-20-7)9(14,15)11(18,19)10(8,16)17;/h1-11,16H;1-4H;/q;-1;/p+1/b14-11-;; |
| InChIKey | SYJMDRLYPMBURN-LVDFRVDWSA-O |
| XLogP | 7.00 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.63 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|