C17H9F8IrN2O2- — CID 59005871
iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;pyridine-2-carboxylic acid (PubChem CID 59005871) has the molecular formula C17H9F8IrN2O2- and a molecular weight of 617.47 g/mol. Its IUPAC name is iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;pyridine-2-carboxylic acid.
| Compound Name | iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59005871 |
| Molecular Formula | C17H9F8IrN2O2- |
| Molecular Weight | 617.47 g/mol |
| Exact Mass | 618.02 |
| IUPAC Name | iridium;2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)pyridine;pyridine-2-carboxylic acid |
| SMILES | FC1(F)[C-]=C(c2ccccn2)C(F)(F)C(F)(F)C1(F)F.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C11H4F8N.C6H5NO2.Ir/c12-8(13)5-6(7-3-1-2-4-20-7)9(14,15)11(18,19)10(8,16)17;8-6(9)5-3-1-2-4-7-5;/h1-4H;1-4H,(H,8,9);/q-1;; |
| InChIKey | GOXYUPDTLBTZFG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|