About 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole
5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole (PubChem CID 59006218) has the molecular formula C11H14F3N3O3S
and a molecular weight of 325.31 g/mol. Its IUPAC name is 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole |
| PubChem CID | 59006218 |
| Molecular Formula | C11H14F3N3O3S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole |
| SMILES | Cn1ncc(C(F)(F)F)c1CS(=O)(=O)C1=NOC(C)(C)C1 |
| InChI | InChI=1S/C11H14F3N3O3S/c1-10(2)4-9(16-20-10)21(18,19)6-8-7(11(12,13)14)5-15-17(8)3/h5H,4,6H2,1-3H3 |
| InChIKey | PQIAERMCXKLFKJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole?
The IUPAC name of 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole (CID 59006218) is 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole.
What is the SMILES notation for 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole?
The canonical SMILES for 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole is Cn1ncc(C(F)(F)F)c1CS(=O)(=O)C1=NOC(C)(C)C1.
What is the InChIKey of 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole?
The InChIKey is PQIAERMCXKLFKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3O3S/c1-10(2)4-9(16-20-10)21(18,19)6-8-7(11(12,13)14)5-15-17(8)3/h5H,4,6H2,1-3H3.
What are the key properties of 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole?
5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole has a molecular weight of 325.31 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-[[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methylsulfonyl]-4H-1,2-oxazole is sourced from PubChem (CID 59006218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).