About (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane
(3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane (PubChem CID 590063) has the molecular formula C13H30OSi2
and a molecular weight of 258.55 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane |
| PubChem CID | 590063 |
| Molecular Formula | C13H30OSi2 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane |
| SMILES | CC1CCC(O[Si](C)(C)[Si](C)(C)C)CC1C |
| InChI | InChI=1S/C13H30OSi2/c1-11-8-9-13(10-12(11)2)14-16(6,7)15(3,4)5/h11-13H,8-10H2,1-7H3 |
| InChIKey | JIXWQTNIPBMSIC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane?
The IUPAC name of (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane (CID 590063) is (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane.
What is the SMILES notation for (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane?
The canonical SMILES for (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane is CC1CCC(O[Si](C)(C)[Si](C)(C)C)CC1C.
What is the InChIKey of (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane?
The InChIKey is JIXWQTNIPBMSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30OSi2/c1-11-8-9-13(10-12(11)2)14-16(6,7)15(3,4)5/h11-13H,8-10H2,1-7H3.
What are the key properties of (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane?
(3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane has a molecular weight of 258.55 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylcyclohexyl)oxy-dimethyl-trimethylsilylsilane is sourced from PubChem (CID 590063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).