About tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate
tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate (PubChem CID 59006606) has the molecular formula C8H15ClN2O3
and a molecular weight of 222.67 g/mol. Its IUPAC name is tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate |
| PubChem CID | 59006606 |
| Molecular Formula | C8H15ClN2O3 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)/C(Cl)=N/O |
| InChI | InChI=1S/C8H15ClN2O3/c1-5(6(9)11-13)10-7(12)14-8(2,3)4/h5,13H,1-4H3,(H,10,12)/b11-6-/t5-/m1/s1 |
| InChIKey | GOINUHXIESPGBM-UQPIDIEJSA-N |
| XLogP | 1.93 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate (CID 59006606) is tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate is C[C@@H](NC(=O)OC(C)(C)C)/C(Cl)=N/O.
What is the InChIKey of tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate?
The InChIKey is GOINUHXIESPGBM-UQPIDIEJSA-N. The full InChI is InChI=1S/C8H15ClN2O3/c1-5(6(9)11-13)10-7(12)14-8(2,3)4/h5,13H,1-4H3,(H,10,12)/b11-6-/t5-/m1/s1.
What are the key properties of tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate?
tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate has a molecular weight of 222.67 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1Z,2R)-1-chloro-1-hydroxyiminopropan-2-yl]carbamate is sourced from PubChem (CID 59006606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).