About methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate
methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate (PubChem CID 59006704) has the molecular formula C16H17F2N3OS
and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate.
Molecular Properties
| Compound Name | methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate |
| PubChem CID | 59006704 |
| Molecular Formula | C16H17F2N3OS |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate |
| SMILES | C/N=C(\SC)N1CCC[C@@H]1c1cc(-c2cc(F)ccc2F)on1 |
| InChI | InChI=1S/C16H17F2N3OS/c1-19-16(23-2)21-7-3-4-14(21)13-9-15(22-20-13)11-8-10(17)5-6-12(11)18/h5-6,8-9,14H,3-4,7H2,1-2H3/b19-16-/t14-/m1/s1 |
| InChIKey | UJWAJFZBNKPYKP-DZTQIWHNSA-N |
| XLogP | 4.11 |
| TPSA | 41.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
The IUPAC name of methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate (CID 59006704) is methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate.
What is the SMILES notation for methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
The canonical SMILES for methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate is C/N=C(\SC)N1CCC[C@@H]1c1cc(-c2cc(F)ccc2F)on1.
What is the InChIKey of methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
The InChIKey is UJWAJFZBNKPYKP-DZTQIWHNSA-N. The full InChI is InChI=1S/C16H17F2N3OS/c1-19-16(23-2)21-7-3-4-14(21)13-9-15(22-20-13)11-8-10(17)5-6-12(11)18/h5-6,8-9,14H,3-4,7H2,1-2H3/b19-16-/t14-/m1/s1.
What are the key properties of methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate?
methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate has a molecular weight of 337.40 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[5-(2,5-difluorophenyl)-1,2-oxazol-3-yl]-N-methylpyrrolidine-1-carboximidothioate is sourced from PubChem (CID 59006704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).