C30H28ClN7O2S — CID 59006944
N-[4-[4-(azetidin-1-yl)-6-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-4-phenoxybenzamide (PubChem CID 59006944) has the molecular formula C30H28ClN7O2S and a molecular weight of 586.12 g/mol. Its IUPAC name is N-[4-[4-(azetidin-1-yl)-6-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-4-phenoxybenzamide.
| Compound Name | N-[4-[4-(azetidin-1-yl)-6-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-4-phenoxybenzamide |
|---|---|
| PubChem CID | 59006944 |
| Molecular Formula | C30H28ClN7O2S |
| Molecular Weight | 586.12 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | N-[4-[4-(azetidin-1-yl)-6-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-4-phenoxybenzamide |
| SMILES | C/C(N)=C/C(N)=N/c1cc(N2CCC2)nc(Sc2ccc(NC(=O)c3ccc(Oc4ccccc4)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C30H28ClN7O2S/c1-19(32)16-26(33)35-27-18-28(38-14-5-15-38)37-30(36-27)41-23-11-8-20(9-12-23)34-29(39)24-13-10-22(17-25(24)31)40-21-6-3-2-4-7-21/h2-4,6-13,16-18H,5,14-15,32H2,1H3,(H,34,39)(H2,33,35,36,37)/b19-16- |
| InChIKey | VJVYPSPKTQQUHA-MNDPQUGUSA-N |
| XLogP | 6.39 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.12 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|