About 5-cyclopentyl-3-methyl-1,2,4-oxadiazole
5-cyclopentyl-3-methyl-1,2,4-oxadiazole (PubChem CID 59007020) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-cyclopentyl-3-methyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-cyclopentyl-3-methyl-1,2,4-oxadiazole |
| PubChem CID | 59007020 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 5-cyclopentyl-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(C2CCCC2)n1 |
| InChI | InChI=1S/C8H12N2O/c1-6-9-8(11-10-6)7-4-2-3-5-7/h7H,2-5H2,1H3 |
| InChIKey | QJTXKKSYFRFTDA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentyl-3-methyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-3-methyl-1,2,4-oxadiazole?
The IUPAC name of 5-cyclopentyl-3-methyl-1,2,4-oxadiazole (CID 59007020) is 5-cyclopentyl-3-methyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-cyclopentyl-3-methyl-1,2,4-oxadiazole?
The canonical SMILES for 5-cyclopentyl-3-methyl-1,2,4-oxadiazole is Cc1noc(C2CCCC2)n1.
What is the InChIKey of 5-cyclopentyl-3-methyl-1,2,4-oxadiazole?
The InChIKey is QJTXKKSYFRFTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-9-8(11-10-6)7-4-2-3-5-7/h7H,2-5H2,1H3.
What are the key properties of 5-cyclopentyl-3-methyl-1,2,4-oxadiazole?
5-cyclopentyl-3-methyl-1,2,4-oxadiazole has a molecular weight of 152.20 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-3-methyl-1,2,4-oxadiazole is sourced from PubChem (CID 59007020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).