C9H16O2 — CID 59007348
(2Z,4E)-4-propan-2-ylhexa-2,4-diene-1,5-diol (PubChem CID 59007348) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (2Z,4E)-4-propan-2-ylhexa-2,4-diene-1,5-diol.
| Compound Name | (2Z,4E)-4-propan-2-ylhexa-2,4-diene-1,5-diol |
|---|---|
| PubChem CID | 59007348 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2Z,4E)-4-propan-2-ylhexa-2,4-diene-1,5-diol |
| SMILES | C/C(O)=C(\C=C/CO)C(C)C |
| InChI | InChI=1S/C9H16O2/c1-7(2)9(8(3)11)5-4-6-10/h4-5,7,10-11H,6H2,1-3H3/b5-4-,9-8- |
| InChIKey | UTXPEBWKPAUIAD-WPAMCMATSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|