About tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate
tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate (PubChem CID 59007431) has the molecular formula C23H44N2O2
and a molecular weight of 380.62 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate |
| PubChem CID | 59007431 |
| Molecular Formula | C23H44N2O2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate |
| SMILES | CCCCCCC1CCCN(C[C@@H]2CCCC[C@H]2NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H44N2O2/c1-5-6-7-8-12-19-13-11-16-25(17-19)18-20-14-9-10-15-21(20)24-22(26)27-23(2,3)4/h19-21H,5-18H2,1-4H3,(H,24,26)/t19?,20-,21+/m0/s1 |
| InChIKey | GUHQZXOJXSCJON-GJGLBJJNSA-N |
| XLogP | 5.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate?
The IUPAC name of tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate (CID 59007431) is tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate?
The canonical SMILES for tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate is CCCCCCC1CCCN(C[C@@H]2CCCC[C@H]2NC(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate?
The InChIKey is GUHQZXOJXSCJON-GJGLBJJNSA-N. The full InChI is InChI=1S/C23H44N2O2/c1-5-6-7-8-12-19-13-11-16-25(17-19)18-20-14-9-10-15-21(20)24-22(26)27-23(2,3)4/h19-21H,5-18H2,1-4H3,(H,24,26)/t19?,20-,21+/m0/s1.
What are the key properties of tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate?
tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate has a molecular weight of 380.62 g/mol, XLogP of 5.75, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R,2S)-2-[(3-hexylpiperidin-1-yl)methyl]cyclohexyl]carbamate is sourced from PubChem (CID 59007431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).