C24H18F3N3O3S — CID 59007913
1,1,1-trifluoro-N-[4-[2-[6-[2-(1-hydroxyethyl)phenyl]-1H-benzimidazol-2-yl]ethynyl]phenyl]methanesulfonamide (PubChem CID 59007913) has the molecular formula C24H18F3N3O3S and a molecular weight of 485.49 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[4-[2-[6-[2-(1-hydroxyethyl)phenyl]-1H-benzimidazol-2-yl]ethynyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[4-[2-[6-[2-(1-hydroxyethyl)phenyl]-1H-benzimidazol-2-yl]ethynyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59007913 |
| Molecular Formula | C24H18F3N3O3S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1,1,1-trifluoro-N-[4-[2-[6-[2-(1-hydroxyethyl)phenyl]-1H-benzimidazol-2-yl]ethynyl]phenyl]methanesulfonamide |
| SMILES | CC(O)c1ccccc1-c1ccc2nc(C#Cc3ccc(NS(=O)(=O)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H18F3N3O3S/c1-15(31)19-4-2-3-5-20(19)17-9-12-21-22(14-17)29-23(28-21)13-8-16-6-10-18(11-7-16)30-34(32,33)24(25,26)27/h2-7,9-12,14-15,30-31H,1H3,(H,28,29) |
| InChIKey | LWUSNJNLBQDJAF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|