C22H18BrN3O2S — CID 59008050
2-[2-[(E)-2-(3-bromophenyl)ethenyl]-3H-benzimidazol-5-yl]-N-methylbenzenesulfonamide (PubChem CID 59008050) has the molecular formula C22H18BrN3O2S and a molecular weight of 468.38 g/mol. Its IUPAC name is 2-[2-[(E)-2-(3-bromophenyl)ethenyl]-3H-benzimidazol-5-yl]-N-methylbenzenesulfonamide.
| Compound Name | 2-[2-[(E)-2-(3-bromophenyl)ethenyl]-3H-benzimidazol-5-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 59008050 |
| Molecular Formula | C22H18BrN3O2S |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-[2-[(E)-2-(3-bromophenyl)ethenyl]-3H-benzimidazol-5-yl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1-c1ccc2nc(/C=C/c3cccc(Br)c3)[nH]c2c1 |
| InChI | InChI=1S/C22H18BrN3O2S/c1-24-29(27,28)21-8-3-2-7-18(21)16-10-11-19-20(14-16)26-22(25-19)12-9-15-5-4-6-17(23)13-15/h2-14,24H,1H3,(H,25,26)/b12-9+ |
| InChIKey | WOTRWENPURLKBJ-FMIVXFBMSA-N |
| XLogP | 5.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |