About 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide
2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 59008051) has the molecular formula C21H15F2N3O2S
and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
| PubChem CID | 59008051 |
| Molecular Formula | C21H15F2N3O2S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc2nc(/C=C/c3cc(F)ccc3F)[nH]c2c1 |
| InChI | InChI=1S/C21H15F2N3O2S/c22-15-7-8-17(23)14(11-15)6-10-21-25-18-9-5-13(12-19(18)26-21)16-3-1-2-4-20(16)29(24,27)28/h1-12H,(H,25,26)(H2,24,27,28)/b10-6+ |
| InChIKey | GOGJSMQYYQBVHM-UXBLZVDNSA-N |
| XLogP | 4.33 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide?
The IUPAC name of 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide (CID 59008051) is 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide.
What is the SMILES notation for 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide?
The canonical SMILES for 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide is NS(=O)(=O)c1ccccc1-c1ccc2nc(/C=C/c3cc(F)ccc3F)[nH]c2c1.
What is the InChIKey of 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide?
The InChIKey is GOGJSMQYYQBVHM-UXBLZVDNSA-N. The full InChI is InChI=1S/C21H15F2N3O2S/c22-15-7-8-17(23)14(11-15)6-10-21-25-18-9-5-13(12-19(18)26-21)16-3-1-2-4-20(16)29(24,27)28/h1-12H,(H,25,26)(H2,24,27,28)/b10-6+.
What are the key properties of 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide?
2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide has a molecular weight of 411.43 g/mol, XLogP of 4.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(E)-2-(2,5-difluorophenyl)ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide is sourced from PubChem (CID 59008051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).