About [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate
[4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate (PubChem CID 59008154) has the molecular formula C15H14BrClO5
and a molecular weight of 389.63 g/mol. Its IUPAC name is [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate.
Molecular Properties
| Compound Name | [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate |
| PubChem CID | 59008154 |
| Molecular Formula | C15H14BrClO5 |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate |
| SMILES | COc1ccc(C2=CC(COC(=O)CCCl)OC2=O)cc1Br |
| InChI | InChI=1S/C15H14BrClO5/c1-20-13-3-2-9(6-12(13)16)11-7-10(22-15(11)19)8-21-14(18)4-5-17/h2-3,6-7,10H,4-5,8H2,1H3 |
| InChIKey | GRXCJYJTMUIBBF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate?
The IUPAC name of [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate (CID 59008154) is [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate.
What is the SMILES notation for [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate?
The canonical SMILES for [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate is COc1ccc(C2=CC(COC(=O)CCCl)OC2=O)cc1Br.
What is the InChIKey of [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate?
The InChIKey is GRXCJYJTMUIBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrClO5/c1-20-13-3-2-9(6-12(13)16)11-7-10(22-15(11)19)8-21-14(18)4-5-17/h2-3,6-7,10H,4-5,8H2,1H3.
What are the key properties of [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate?
[4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate has a molecular weight of 389.63 g/mol, XLogP of 2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-bromo-4-methoxyphenyl)-5-oxo-2H-furan-2-yl]methyl 3-chloropropanoate is sourced from PubChem (CID 59008154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).