C28H35Cl2N3O4S2 — CID 59008230
N-[(2S)-1-[3-[butyl-(2,4-dichlorophenyl)sulfonylamino]propylamino]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 59008230) has the molecular formula C28H35Cl2N3O4S2 and a molecular weight of 612.65 g/mol. Its IUPAC name is N-[(2S)-1-[3-[butyl-(2,4-dichlorophenyl)sulfonylamino]propylamino]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(2S)-1-[3-[butyl-(2,4-dichlorophenyl)sulfonylamino]propylamino]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 59008230 |
| Molecular Formula | C28H35Cl2N3O4S2 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | N-[(2S)-1-[3-[butyl-(2,4-dichlorophenyl)sulfonylamino]propylamino]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CCCCN(CCCNC(=O)[C@H](CC(C)C)NC(=O)c1cc2ccccc2s1)S(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H35Cl2N3O4S2/c1-4-5-14-33(39(36,37)26-12-11-21(29)18-22(26)30)15-8-13-31-27(34)23(16-19(2)3)32-28(35)25-17-20-9-6-7-10-24(20)38-25/h6-7,9-12,17-19,23H,4-5,8,13-16H2,1-3H3,(H,31,34)(H,32,35)/t23-/m0/s1 |
| InChIKey | ORFIVMQNINCDDW-QHCPKHFHSA-N |
| XLogP | 6.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|