C10H11F9N2 — CID 59008519
1-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2H-imidazole (PubChem CID 59008519) has the molecular formula C10H11F9N2 and a molecular weight of 330.19 g/mol. Its IUPAC name is 1-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2H-imidazole.
| Compound Name | 1-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2H-imidazole |
|---|---|
| PubChem CID | 59008519 |
| Molecular Formula | C10H11F9N2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-2H-imidazole |
| SMILES | CN1C=CN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H11F9N2/c1-20-4-5-21(6-20)3-2-7(11,12)8(13,14)9(15,16)10(17,18)19/h4-5H,2-3,6H2,1H3 |
| InChIKey | VNPQJEAXWTWTBP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|