C10H12F8N2 — CID 59008520
1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole (PubChem CID 59008520) has the molecular formula C10H12F8N2 and a molecular weight of 312.20 g/mol. Its IUPAC name is 1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole.
| Compound Name | 1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole |
|---|---|
| PubChem CID | 59008520 |
| Molecular Formula | C10H12F8N2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-ethyl-3-(2,2,3,3,4,4,5,5-octafluoropentyl)-2H-imidazole |
| SMILES | CCN1C=CN(CC(F)(F)C(F)(F)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C10H12F8N2/c1-2-19-3-4-20(6-19)5-8(13,14)10(17,18)9(15,16)7(11)12/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | OCBLEAYBGQZVCH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|