C17H27F3O7 — CID 59008597
1-O-ethyl 3-O-(2-hydroxypropyl) 5-O-(2,2,2-trifluoroethyl) 1-methylhexane-1,3,5-tricarboxylate (PubChem CID 59008597) has the molecular formula C17H27F3O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(2-hydroxypropyl) 5-O-(2,2,2-trifluoroethyl) 1-methylhexane-1,3,5-tricarboxylate.
| Compound Name | 1-O-ethyl 3-O-(2-hydroxypropyl) 5-O-(2,2,2-trifluoroethyl) 1-methylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59008597 |
| Molecular Formula | C17H27F3O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-O-ethyl 3-O-(2-hydroxypropyl) 5-O-(2,2,2-trifluoroethyl) 1-methylhexane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)C(C)CC(CC(C)C(=O)OCC(F)(F)F)C(=O)OCC(C)O |
| InChI | InChI=1S/C17H27F3O7/c1-5-25-14(22)10(2)6-13(16(24)26-8-12(4)21)7-11(3)15(23)27-9-17(18,19)20/h10-13,21H,5-9H2,1-4H3 |
| InChIKey | QQBIMBHIEJWZKD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|