C24H24F13N2+ — CID 59008662
4-(4-pyridin-4-ylhexan-2-yl)-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyridin-1-ium (PubChem CID 59008662) has the molecular formula C24H24F13N2+ and a molecular weight of 587.44 g/mol. Its IUPAC name is 4-(4-pyridin-4-ylhexan-2-yl)-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyridin-1-ium.
| Compound Name | 4-(4-pyridin-4-ylhexan-2-yl)-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyridin-1-ium |
|---|---|
| PubChem CID | 59008662 |
| Molecular Formula | C24H24F13N2+ |
| Molecular Weight | 587.44 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 4-(4-pyridin-4-ylhexan-2-yl)-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyridin-1-ium |
| SMILES | CCC(CC(C)c1cc[n+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccncc1 |
| InChI | InChI=1S/C24H24F13N2/c1-3-16(18-4-9-38-10-5-18)14-15(2)17-6-11-39(12-7-17)13-8-19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h4-7,9-12,15-16H,3,8,13-14H2,1-2H3/q+1 |
| InChIKey | FZCVLCNKYJQQQZ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.44 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|