C16H17BFNO — CID 59008740
3'-fluoro-8,8-dimethylspiro[8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene-7,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene] (PubChem CID 59008740) has the molecular formula C16H17BFNO and a molecular weight of 269.13 g/mol. Its IUPAC name is 3'-fluoro-8,8-dimethylspiro[8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene-7,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene].
| Compound Name | 3'-fluoro-8,8-dimethylspiro[8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene-7,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene] |
|---|---|
| PubChem CID | 59008740 |
| Molecular Formula | C16H17BFNO |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3'-fluoro-8,8-dimethylspiro[8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene-7,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1(6),2,4-triene] |
| SMILES | C[N+]1(C)Cc2ccccc2[B-]12OCc1cc(F)ccc12 |
| InChI | InChI=1S/C16H17BFNO/c1-19(2)10-12-5-3-4-6-15(12)17(19)16-8-7-14(18)9-13(16)11-20-17/h3-9H,10-11H2,1-2H3 |
| InChIKey | LTSXBYXUWGWUEJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|