About [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium
[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium (PubChem CID 59008763) has the molecular formula C17H20BFNO+
and a molecular weight of 284.16 g/mol. Its IUPAC name is [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium.
Molecular Properties
| Compound Name | [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium |
| PubChem CID | 59008763 |
| Molecular Formula | C17H20BFNO+ |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium |
| SMILES | C[N+](C)(C)Cc1cccc(B2OCc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C17H20BFNO/c1-20(2,3)11-13-5-4-6-15(9-13)18-17-8-7-16(19)10-14(17)12-21-18/h4-10H,11-12H2,1-3H3/q+1 |
| InChIKey | CCTUZXCEVZYKEN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium?
The IUPAC name of [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium (CID 59008763) is [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium.
What is the SMILES notation for [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium?
The canonical SMILES for [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium is C[N+](C)(C)Cc1cccc(B2OCc3cc(F)ccc32)c1.
What is the InChIKey of [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium?
The InChIKey is CCTUZXCEVZYKEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20BFNO/c1-20(2,3)11-13-5-4-6-15(9-13)18-17-8-7-16(19)10-14(17)12-21-18/h4-10H,11-12H2,1-3H3/q+1.
What are the key properties of [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium?
[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium has a molecular weight of 284.16 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl-trimethylazanium is sourced from PubChem (CID 59008763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).