About 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine
1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine (PubChem CID 59008800) has the molecular formula C19H22BFN2O
and a molecular weight of 324.21 g/mol. Its IUPAC name is 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine |
| PubChem CID | 59008800 |
| Molecular Formula | C19H22BFN2O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine |
| SMILES | CN1CCN(Cc2cccc(B3OCc4cc(F)ccc43)c2)CC1 |
| InChI | InChI=1S/C19H22BFN2O/c1-22-7-9-23(10-8-22)13-15-3-2-4-17(11-15)20-19-6-5-18(21)12-16(19)14-24-20/h2-6,11-12H,7-10,13-14H2,1H3 |
| InChIKey | CNFPMNXVYKNDTE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine?
The IUPAC name of 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine (CID 59008800) is 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine.
What is the SMILES notation for 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine?
The canonical SMILES for 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine is CN1CCN(Cc2cccc(B3OCc4cc(F)ccc43)c2)CC1.
What is the InChIKey of 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine?
The InChIKey is CNFPMNXVYKNDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22BFN2O/c1-22-7-9-23(10-8-22)13-15-3-2-4-17(11-15)20-19-6-5-18(21)12-16(19)14-24-20/h2-6,11-12H,7-10,13-14H2,1H3.
What are the key properties of 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine?
1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine has a molecular weight of 324.21 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methyl]-4-methylpiperazine is sourced from PubChem (CID 59008800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).