C38H29N7ORu — CID 59008922
bis(1,10-phenanthroline);2-(1,10-phenanthrolin-5-yloxy)ethanamine;ruthenium (PubChem CID 59008922) has the molecular formula C38H29N7ORu and a molecular weight of 700.77 g/mol. Its IUPAC name is bis(1,10-phenanthroline);2-(1,10-phenanthrolin-5-yloxy)ethanamine;ruthenium.
| Compound Name | bis(1,10-phenanthroline);2-(1,10-phenanthrolin-5-yloxy)ethanamine;ruthenium |
|---|---|
| PubChem CID | 59008922 |
| Molecular Formula | C38H29N7ORu |
| Molecular Weight | 700.77 g/mol |
| Exact Mass | 701.15 |
| IUPAC Name | bis(1,10-phenanthroline);2-(1,10-phenanthrolin-5-yloxy)ethanamine;ruthenium |
| SMILES | NCCOc1cc2cccnc2c2ncccc12.[Ru].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C14H13N3O.2C12H8N2.Ru/c15-5-8-18-12-9-10-3-1-6-16-13(10)14-11(12)4-2-7-17-14;2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-4,6-7,9H,5,8,15H2;2*1-8H; |
| InChIKey | LPXYRPFHAGYECB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.77 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|