About (4-cyanophenyl) 4-propylbenzoate
(4-cyanophenyl) 4-propylbenzoate (PubChem CID 590092) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is (4-cyanophenyl) 4-propylbenzoate.
Molecular Properties
| Compound Name | (4-cyanophenyl) 4-propylbenzoate |
| PubChem CID | 590092 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (4-cyanophenyl) 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C17H15NO2/c1-2-3-13-4-8-15(9-5-13)17(19)20-16-10-6-14(12-18)7-11-16/h4-11H,2-3H2,1H3 |
| InChIKey | NCTWNVKZQMMLIV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 4-propylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 4-propylbenzoate?
The IUPAC name of (4-cyanophenyl) 4-propylbenzoate (CID 590092) is (4-cyanophenyl) 4-propylbenzoate.
What is the SMILES notation for (4-cyanophenyl) 4-propylbenzoate?
The canonical SMILES for (4-cyanophenyl) 4-propylbenzoate is CCCc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1.
What is the InChIKey of (4-cyanophenyl) 4-propylbenzoate?
The InChIKey is NCTWNVKZQMMLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c1-2-3-13-4-8-15(9-5-13)17(19)20-16-10-6-14(12-18)7-11-16/h4-11H,2-3H2,1H3.
What are the key properties of (4-cyanophenyl) 4-propylbenzoate?
(4-cyanophenyl) 4-propylbenzoate has a molecular weight of 265.31 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 4-propylbenzoate is sourced from PubChem (CID 590092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).