C24H26F3NO4 — CID 59009416
benzyl 4-[1-ethoxy-1-oxo-3-(2,4,5-trifluorophenyl)propan-2-yl]piperidine-1-carboxylate (PubChem CID 59009416) has the molecular formula C24H26F3NO4 and a molecular weight of 449.47 g/mol. Its IUPAC name is benzyl 4-[1-ethoxy-1-oxo-3-(2,4,5-trifluorophenyl)propan-2-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[1-ethoxy-1-oxo-3-(2,4,5-trifluorophenyl)propan-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59009416 |
| Molecular Formula | C24H26F3NO4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | benzyl 4-[1-ethoxy-1-oxo-3-(2,4,5-trifluorophenyl)propan-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C(Cc1cc(F)c(F)cc1F)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26F3NO4/c1-2-31-23(29)19(12-18-13-21(26)22(27)14-20(18)25)17-8-10-28(11-9-17)24(30)32-15-16-6-4-3-5-7-16/h3-7,13-14,17,19H,2,8-12,15H2,1H3 |
| InChIKey | GVTSKOADGBXDPH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|