C17H30N2O3S — CID 59009607
trans-(1S,2S)-1-tert-butyl-2-ethenyl-N-[2-(methylamino)cyclohexyl]sulfonylcyclopropane-1-carboxamide (PubChem CID 59009607) has the molecular formula C17H30N2O3S and a molecular weight of 342.51 g/mol. Its IUPAC name is trans-(1S,2S)-1-tert-butyl-2-ethenyl-N-[2-(methylamino)cyclohexyl]sulfonylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-1-tert-butyl-2-ethenyl-N-[2-(methylamino)cyclohexyl]sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59009607 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | trans-(1S,2S)-1-tert-butyl-2-ethenyl-N-[2-(methylamino)cyclohexyl]sulfonylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C1CCCCC1NC)C(C)(C)C |
| InChI | InChI=1S/C17H30N2O3S/c1-6-12-11-17(12,16(2,3)4)15(20)19-23(21,22)14-10-8-7-9-13(14)18-5/h6,12-14,18H,1,7-11H2,2-5H3,(H,19,20)/t12-,13?,14?,17-/m1/s1 |
| InChIKey | ZEIHSZGXVHXVTI-QROZZAMVSA-N |
| XLogP | 2.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|