C17H20N2O4S — CID 59009627
cis-(1R,2S)-2-ethenyl-N-[(2-oxo-1,3-dihydroindol-7-yl)sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide (PubChem CID 59009627) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is cis-(1R,2S)-2-ethenyl-N-[(2-oxo-1,3-dihydroindol-7-yl)sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-ethenyl-N-[(2-oxo-1,3-dihydroindol-7-yl)sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59009627 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | cis-(1R,2S)-2-ethenyl-N-[(2-oxo-1,3-dihydroindol-7-yl)sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)c1cccc2c1NC(=O)C2)C(C)C |
| InChI | InChI=1S/C17H20N2O4S/c1-4-12-9-17(12,10(2)3)16(21)19-24(22,23)13-7-5-6-11-8-14(20)18-15(11)13/h4-7,10,12H,1,8-9H2,2-3H3,(H,18,20)(H,19,21)/t12-,17-/m1/s1 |
| InChIKey | TVEAVGSULALOKZ-SJKOYZFVSA-N |
| XLogP | 1.83 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|