C15H21N3O3S — CID 59009648
cis-(1R,2S)-2-ethenyl-N-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide (PubChem CID 59009648) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is cis-(1R,2S)-2-ethenyl-N-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-ethenyl-N-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59009648 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | cis-(1R,2S)-2-ethenyl-N-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1-propan-2-ylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)c1cccnc1NC)C(C)C |
| InChI | InChI=1S/C15H21N3O3S/c1-5-11-9-15(11,10(2)3)14(19)18-22(20,21)12-7-6-8-17-13(12)16-4/h5-8,10-11H,1,9H2,2-4H3,(H,16,17)(H,18,19)/t11-,15-/m1/s1 |
| InChIKey | HVRFAOGHIIRDMF-IAQYHMDHSA-N |
| XLogP | 1.78 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|