C25H18ClF4NO2 — CID 59009870
5-(4-chloro-3-ethylphenoxy)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]quinoline (PubChem CID 59009870) has the molecular formula C25H18ClF4NO2 and a molecular weight of 475.87 g/mol. Its IUPAC name is 5-(4-chloro-3-ethylphenoxy)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]quinoline.
| Compound Name | 5-(4-chloro-3-ethylphenoxy)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]quinoline |
|---|---|
| PubChem CID | 59009870 |
| Molecular Formula | C25H18ClF4NO2 |
| Molecular Weight | 475.87 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 5-(4-chloro-3-ethylphenoxy)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]quinoline |
| SMILES | CCc1cc(Oc2cccc3nc(-c4cccc(OC(F)(F)C(F)F)c4)ccc23)ccc1Cl |
| InChI | InChI=1S/C25H18ClF4NO2/c1-2-15-13-17(9-11-20(15)26)32-23-8-4-7-22-19(23)10-12-21(31-22)16-5-3-6-18(14-16)33-25(29,30)24(27)28/h3-14,24H,2H2,1H3 |
| InChIKey | FBXMBZOPHZBNJK-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.87 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|