About 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole
1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole (PubChem CID 59010136) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole |
| PubChem CID | 59010136 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole |
| SMILES | COCCN1CCN=C1C |
| InChI | InChI=1S/C7H14N2O/c1-7-8-3-4-9(7)5-6-10-2/h3-6H2,1-2H3 |
| InChIKey | QJKFBBKEWPMVSO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole?
The IUPAC name of 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole (CID 59010136) is 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole.
What is the SMILES notation for 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole?
The canonical SMILES for 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole is COCCN1CCN=C1C.
What is the InChIKey of 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole?
The InChIKey is QJKFBBKEWPMVSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-7-8-3-4-9(7)5-6-10-2/h3-6H2,1-2H3.
What are the key properties of 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole?
1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole has a molecular weight of 142.20 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-2-methyl-4,5-dihydroimidazole is sourced from PubChem (CID 59010136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).