C39H43N2+ — CID 59010175
1-benzyl-1,3-dimethyl-2-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzo[e]indol-3-ium (PubChem CID 59010175) has the molecular formula C39H43N2+ and a molecular weight of 539.79 g/mol. Its IUPAC name is 1-benzyl-1,3-dimethyl-2-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzo[e]indol-3-ium.
| Compound Name | 1-benzyl-1,3-dimethyl-2-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 59010175 |
| Molecular Formula | C39H43N2+ |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | 1-benzyl-1,3-dimethyl-2-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzo[e]indol-3-ium |
| SMILES | C[N+]1=C(/C=C/c2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)C(C)(Cc2ccccc2)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H43N2/c1-37(2)20-22-41-23-21-38(3,4)32-25-28(24-31(37)36(32)41)16-19-34-39(5,26-27-12-8-7-9-13-27)35-30-15-11-10-14-29(30)17-18-33(35)40(34)6/h7-19,24-25H,20-23,26H2,1-6H3/q+1 |
| InChIKey | YLTDWVUMNQBRLA-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|