C13H21N2O12S2-3 — CID 59011082
(5S)-5-hydroxy-1-[[(3R,4S)-4-hydroxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methyl]piperidine-3-carboxylate (PubChem CID 59011082) has the molecular formula C13H21N2O12S2-3 and a molecular weight of 461.45 g/mol. Its IUPAC name is (5S)-5-hydroxy-1-[[(3R,4S)-4-hydroxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methyl]piperidine-3-carboxylate.
| Compound Name | (5S)-5-hydroxy-1-[[(3R,4S)-4-hydroxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 59011082 |
| Molecular Formula | C13H21N2O12S2-3 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (5S)-5-hydroxy-1-[[(3R,4S)-4-hydroxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methyl]piperidine-3-carboxylate |
| SMILES | O=C([O-])C1C[C@H](O)CN(C[C@H]2C(COS(=O)(=O)[O-])OCC(NS(=O)(=O)[O-])[C@H]2O)C1 |
| InChI | InChI=1S/C13H24N2O12S2/c16-8-1-7(13(18)19)2-15(3-8)4-9-11(6-27-29(23,24)25)26-5-10(12(9)17)14-28(20,21)22/h7-12,14,16-17H,1-6H2,(H,18,19)(H,20,21,22)(H,23,24,25)/p-3/t7?,8-,9-,10?,11?,12-/m0/s1 |
| InChIKey | JDPAYMAOQZKJNC-GARLHZPDSA-K |
| XLogP | -5.31 |
| TPSA | 228.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|