C24H28N8O — CID 59011461
3-N-[4-(1-isocyano-4-morpholin-4-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine (PubChem CID 59011461) has the molecular formula C24H28N8O and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-N-[4-(1-isocyano-4-morpholin-4-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-(1-isocyano-4-morpholin-4-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 59011461 |
| Molecular Formula | C24H28N8O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 3-N-[4-(1-isocyano-4-morpholin-4-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
| SMILES | [C-]#[N+]C1(c2ccc(Nc3nc(N)n(-c4ccccn4)n3)cc2)CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C24H28N8O/c1-26-24(11-9-20(10-12-24)31-14-16-33-17-15-31)18-5-7-19(8-6-18)28-23-29-22(25)32(30-23)21-4-2-3-13-27-21/h2-8,13,20H,9-12,14-17H2,(H3,25,28,29,30) |
| InChIKey | UFTHSZNDUBFVCD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|